![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
.jpg){kind=link}
![[VID]](/icons/movie.gif){kind=icon}
.jpg){kind=link}
![[ ]](/icons/a.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| workbook.jpg | 2018-04-24 03:34 | 4.6K | |
| wes.gif | 2018-04-24 03:34 | 2.8K | |
| wbimages/ | 2018-04-24 03:34 | - | |
| visamccvv.gif | 2018-04-24 03:34 | 15K | |
| visa.gif | 2018-04-24 03:34 | 402 | |
| view_cart.jpg | 2018-04-24 03:34 | 5.4K | |
| videos.jpg | 2018-04-24 03:34 | 4.1K | |
| video.jpg | 2018-04-24 03:34 | 4.3K | |
| update_cart.jpg | 2018-04-24 03:34 | 3.0K | |
| update.jpg | 2018-04-24 03:34 | 2.1K | |
| up.jpg | 2018-04-24 03:34 | 2.9K | |
| undercurrents.ppt | 2018-04-24 03:34 | 721K | |
| toughadolescent_SM.jpg | 2018-04-24 03:34 | 20K | |
| toughadolescent_LG.jpg | 2018-04-24 03:34 | 54K | |
| top_gradient_full.jpg | 2018-04-24 03:34 | 1.4K | |
| top_gradient_bac.jpg | 2018-04-24 03:34 | 1.1K | |
| top_gradient.jpg | 2018-04-24 03:34 | 860 | |
| top2.jpg | 2018-04-24 03:34 | 3.0K | |
| top.jpg | 2018-04-24 03:34 | 3.4K | |
| text1.jpg | 2018-04-24 03:34 | 14K | |
| testimonials.htm | 2018-04-24 03:34 | 5.8K | |
| teenworkbook_SM.jpg | 2018-04-24 03:34 | 18K | |
| teenworkbook_LG.jpg | 2018-04-24 03:34 | 57K | |
| teen.jpg | 2018-04-24 03:34 | 8.5K | |
| survivalstudyguide_S..> | 2018-04-24 03:34 | 19K | |
| survivalstudyguide_L..> | 2018-04-24 03:34 | 53K | |
| survivalkit50.JPG | 2018-04-24 03:34 | 20K | |
| survivalkit35.JPG | 2018-04-24 03:34 | 11K | |
| survivalkit.JPG | 2018-04-24 03:34 | 40K | |
| survival_kit.jpg | 2018-04-24 03:34 | 11K | |
| stephanie.jpg | 2018-04-24 03:34 | 14K | |
| spacer.gif | 2018-04-24 03:34 | 49 | |
| sells.jpg | 2018-04-24 03:34 | 2.5K | |
| sel_address.gif | 2018-04-24 03:34 | 1.2K | |
| rosemond.jpg | 2018-04-24 03:34 | 2.5K | |
| robert.jpg | 2018-04-24 03:34 | 13K | |
| research3chart.gif | 2018-04-24 03:34 | 5.7K | |
| register_button.gif | 2018-04-24 03:34 | 1.4K | |
| rashmi.jpg | 2018-04-24 03:34 | 3.4K | |
| r9.jpg | 2018-04-24 03:34 | 42K | |
| r8.jpg | 2018-04-24 03:34 | 73K | |
| r7.jpg | 2018-04-24 03:34 | 67K | |
| r6.jpg | 2018-04-24 03:34 | 51K | |
| r5.jpg | 2018-04-24 03:34 | 61K | |
| r4.jpg | 2018-04-24 03:34 | 42K | |
| r3.jpg | 2018-04-24 03:34 | 71K | |
| r2.jpg | 2018-04-24 03:34 | 74K | |
| r1.jpg | 2018-04-24 03:34 | 85K | |
| psychotherapynetwork..> | 2018-04-24 03:34 | 10K | |
| psychotherapynetwork..> | 2018-04-24 03:34 | 14K | |
| psychnet0708.pdf | 2018-04-24 03:34 | 215K | |
| professional2.jpg | 2018-04-24 03:34 | 6.8K | |
| professional.jpg | 2018-04-24 03:34 | 2.6K | |
| processing.jpg | 2018-04-24 03:34 | 3.4K | |
| process_order.gif | 2018-04-24 03:34 | 1.1K | |
| pll1.jpg | 2018-04-24 03:34 | 15K | |
| paysafe.jpg | 2018-04-24 03:34 | 2.5K | |
| parentworkbook_SM.jpg | 2018-04-24 03:34 | 17K | |
| parentworkbook_LG.jpg | 2018-04-24 03:34 | 49K | |
| parentingmodel_SM.jpg | 2018-04-24 03:34 | 15K | |
| parentingmodel_LG.jpg | 2018-04-24 03:34 | 45K | |
| parentclassSPAN-DVD_..> | 2018-04-24 03:34 | 16K | |
| parentclassSPAN-DVD_..> | 2018-04-24 03:34 | 50K | |
| parentclass-DVD_SM.jpg | 2018-04-24 03:34 | 15K | |
| parentclass-DVD_LG.jpg | 2018-04-24 03:34 | 47K | |
| pam.gif | 2018-04-24 03:34 | 3.0K | |
| overviewpll.jpg | 2018-04-24 03:34 | 50K | |
| notePad.jpg | 2018-04-24 03:34 | 4.6K | |
| newsletter-new-info.gif | 2018-04-24 03:34 | 2.4K | |
| new_address.gif | 2018-04-24 03:34 | 719 | |
| nav_store.jpg | 2018-04-24 03:34 | 3.7K | |
| nav_setup_workshop.gif | 2018-04-24 03:34 | 877 | |
| nav_sample.jpg | 2018-04-24 03:34 | 5.9K | |
| nav_register.jpg | 2018-04-24 03:34 | 5.2K | |
| nav_more.jpg | 2018-04-24 03:34 | 1.2K | |
| nav_discuss.jpg | 2018-04-24 03:34 | 4.9K | |
| nav_calanderold.jpg | 2018-04-24 03:34 | 2.7K | |
| nav_calander.jpg | 2018-04-24 03:34 | 7.7K | |
| na.jpg | 2018-04-24 03:34 | 3.6K | |
| monti.jpg | 2018-04-24 03:34 | 4.3K | |
| moira.jpg | 2018-04-24 03:34 | 2.5K | |
| microsoftword.gif | 2018-04-24 03:34 | 1.3K | |
| michaelcoffman-d.jpg | 2018-04-24 03:34 | 2.0K | |
| mentalhealth.jpg | 2018-04-24 03:34 | 5.2K | |
| mc.gif | 2018-04-24 03:34 | 661 | |
| mark_parrish.jpg | 2018-04-24 03:34 | 3.2K | |
| mailer.jpg | 2018-04-24 03:34 | 11K | |
| logo_gray.jpg | 2018-04-24 03:34 | 20K | |
| login.jpg | 2018-04-24 03:34 | 1.8K | |
| lock.jpg | 2018-04-24 03:34 | 6.7K | |
| llinkin.jpg.JPG | 2018-04-24 03:34 | 1.7M | |
| lg_book2.gif | 2018-04-24 03:34 | 2.8K | |
| leadersguidegroupthe..> | 2018-04-24 03:34 | 17K | |
| leadersguidegroupthe..> | 2018-04-24 03:34 | 47K | |
| jenny.jpg | 2018-04-24 03:34 | 2.9K | |
| jburek.jpg | 2018-04-24 03:34 | 1.3K | |
| inputbg.gif | 2018-04-24 03:34 | 1.3K | |
| images/ | 2018-04-24 03:34 | - | |
| image004.jpg | 2018-04-24 03:34 | 7.3K | |
| image004.gif | 2018-04-24 03:34 | 27K | |
| image002.jpg | 2018-04-24 03:34 | 6.5K | |
| headline.htm | 2018-04-24 03:34 | 1.8K | |
| head_right.jpg | 2018-04-24 03:34 | 28K | |
| head_left.jpg | 2018-04-24 03:34 | 8.7K | |
| h_photo7_old.jpg | 2018-04-24 03:34 | 19K | |
| h_photo7.jpg | 2018-04-24 03:34 | 18K | |
| h_photo6.jpg | 2018-04-24 03:34 | 49K | |
| h_photo5.jpg | 2018-04-24 03:34 | 40K | |
| h_photo4.jpg | 2018-04-24 03:34 | 53K | |
| h_photo3.jpg | 2018-04-24 03:34 | 38K | |
| h_photo2.jpg | 2018-04-24 03:34 | 34K | |
| h_photo1.jpg | 2018-04-24 03:34 | 31K | |
| h_logo_old.jpg | 2018-04-24 03:34 | 9.9K | |
| h_logo2.jpg | 2018-04-24 03:34 | 12K | |
| h_logo.jpg | 2018-04-24 03:34 | 10K | |
| h_help.jpg | 2018-04-24 03:34 | 23K | |
| h_find2.jpg | 2018-04-24 03:34 | 30K | |
| h_find.jpg | 2018-04-24 03:34 | 16K | |
| h_contact_old.gif | 2018-04-24 03:34 | 1.8K | |
| h_contact.gif | 2018-04-24 03:34 | 1.8K | |
| h_ask3.jpg | 2018-04-24 03:34 | 23K | |
| h_ask.jpg | 2018-04-24 03:34 | 14K | |
| h_admin.gif | 2018-04-24 03:34 | 8.4K | |
| groupmanual_SM.jpg | 2018-04-24 03:34 | 16K | |
| groupmanual_LG.jpg | 2018-04-24 03:34 | 45K | |
| greg lindsey.jpg | 2018-04-24 03:34 | 5.1K | |
| greg.jpg | 2018-04-24 03:34 | 53K | |
| go.jpg | 2018-04-24 03:34 | 2.8K | |
| go.gif | 2018-04-24 03:34 | 522 | |
| getacro.gif | 2018-04-24 03:34 | 1.5K | |
| folder_blue.jpg | 2018-04-24 03:34 | 2.9K | |
| folder.jpg | 2018-04-24 03:34 | 2.6K | |
| family solutions cop..> | 2018-04-24 03:34 | 13K | |
| family solutions.jpg | 2018-04-24 03:34 | 5.2K | |
| ellen.jpg | 2018-04-24 03:34 | 14K | |
| dlbcolor5.jpg | 2018-04-24 03:34 | 8.1K | |
| discover.gif | 2018-04-24 03:34 | 471 | |
| diana.jpg | 2018-04-24 03:34 | 13K | |
| del_address.gif | 2018-04-24 03:34 | 717 | |
| def_retreat.jpg | 2018-04-24 03:34 | 11K | |
| def_research.jpg | 2018-04-24 03:34 | 6.3K | |
| def_newsletter.jpg | 2018-04-24 03:34 | 7.4K | |
| def_gethelpfast.jpg | 2018-04-24 03:34 | 6.2K | |
| def_findcounselor.jpg | 2018-04-24 03:34 | 10K | |
| def_findPLLcenter.jpg | 2018-04-24 03:34 | 9.7K | |
| dash1.gif | 2018-04-24 03:34 | 45 | |
| continue_shop.jpg | 2018-04-24 03:34 | 4.0K | |
| continue.jpg | 2018-04-24 03:34 | 2.4K | |
| contact.htm | 2018-04-24 03:34 | 9.4K | |
| coeposterdept.jpg | 2018-04-24 03:34 | 8.0K | |
| coebooksdept.jpg | 2018-04-24 03:34 | 11K | |
| clear_address.gif | 2018-04-24 03:34 | 709 | |
| clear.gif | 2018-04-24 03:34 | 43 | |
| check_out.jpg | 2018-04-24 03:34 | 2.8K | |
| certification.jpg | 2018-04-24 03:34 | 4.9K | |
| cert_app_lg.jpg | 2018-04-24 03:34 | 139K | |
| cert_app.jpg | 2018-04-24 03:34 | 11K | |
| carroll.gif | 2018-04-24 03:34 | 3.4K | |
| carroll.JPG | 2018-04-24 03:34 | 11K | |
| cancel_order.jpg | 2018-04-24 03:34 | 3.1K | |
| cancel.jpg | 2018-04-24 03:34 | 2.2K | |
| calimages/ | 2018-04-24 03:34 | - | |
| calender_head2.jpg | 2018-04-24 03:34 | 33K | |
| calender_head.jpg | 2018-04-24 03:34 | 35K | |
| calender.jpg | 2018-04-24 03:34 | 50K | |
| calender.gif | 2018-04-24 03:34 | 19K | |
| btntemplate.psd | 2018-04-24 03:34 | 2.8K | |
| bscully.JPG | 2018-04-24 03:34 | 581K | |
| bottom_gradient_full..> | 2018-04-24 03:34 | 1.4K | |
| bottom_gradient.jpg | 2018-04-24 03:34 | 838 | |
| books.jpg | 2018-04-24 03:34 | 5.4K | |
| book_little.jpg | 2018-04-24 03:34 | 7.2K | |
| book.jpg | 2018-04-24 03:34 | 35K | |
| board_head2.jpg | 2018-04-24 03:34 | 33K | |
| board_head.jpg | 2018-04-24 03:34 | 35K | |
| blink.gif | 2018-04-24 03:34 | 445 | |
| barry0206.jpg | 2018-04-24 03:34 | 4.3K | |
| barry.jpg | 2018-04-24 03:34 | 11K | |
| backup/ | 2018-04-24 03:34 | - | |
| back_text_r2_c2.jpg | 2018-04-24 03:34 | 16K | |
| back_text_2.jpg | 2018-04-24 03:34 | 16K | |
| back_gradient.jpg | 2018-04-24 03:34 | 1.5K | |
| audio.jpg | 2018-04-24 03:34 | 5.1K | |
| amexcvv.gif | 2018-04-24 03:34 | 17K | |
| amex.gif | 2018-04-24 03:34 | 409 | |
| aisledot.jpg | 2018-04-24 03:34 | 654 | |
| agenda_button.gif | 2018-04-24 03:34 | 1.3K | |
| adobepdf.gif | 2018-04-24 03:34 | 1.4K | |
| admin-bkgrd.jpg | 2018-04-24 03:34 | 29K | |
| _notes/ | 2018-04-24 03:34 | - | |
| YearEndReportTemplat..> | 2018-04-24 03:34 | 2.3M | |
| YearEndReportTemplat..> | 2018-04-24 03:34 | 3.3M | |
| YNotebookFlyer.pdf | 2018-04-24 03:34 | 1.6M | |
| Wound feedback loops..> | 2018-04-24 03:34 | 2.3M | |
| Wound Work Sample Pl..> | 2018-04-24 03:34 | 4.6M | |
| Wound Work Playbook ..> | 2018-04-24 03:34 | 103K | |
| Wound Work Playbook.pdf | 2018-04-24 03:34 | 1.1M | |
| Wound Work Coaching ..> | 2018-04-24 03:34 | 661K | |
| WhyTry2.gif | 2018-04-24 03:34 | 2.1K | |
| WhyTry2.JPG | 2018-04-24 03:34 | 12K | |
| WhyTry0104Brochure.pdf | 2018-04-24 03:34 | 202K | |
| WhyTry.gif | 2018-04-24 03:34 | 2.1K | |
| WhyTry.JPG | 2018-04-24 03:34 | 16K | |
| Whereabouts contract..> | 2018-04-24 03:34 | 132K | |
| Weekly Report.pdf | 2018-04-24 03:34 | 629K | |
| Website revision 7-9..> | 2020-11-12 12:53 | 16K | |
| WSPlanner.pdf | 2018-04-24 03:34 | 552K | |
| WSPlanner.doc | 2018-04-24 03:34 | 1.1M | |
| WSChecklist.pdf | 2018-04-24 03:34 | 257K | |
| W-4 Form.pdf | 2018-04-24 03:34 | 100K | |
| Video IPR Measures.pdf | 2018-04-24 03:34 | 570K | |
| Video IPR Measures.doc | 2018-04-24 03:34 | 292K | |
| Video Game Contract.ppt | 2018-04-24 03:34 | 1.0M | |
| VarianceLetter.doc | 2018-04-24 03:34 | 139K | |
| User Confidentiality..> | 2018-04-24 03:34 | 274K | |
| User Confidentiality..> | 2018-04-24 03:34 | 29K | |
| Use of Laptop.ppt | 2018-04-24 03:34 | 1.0M | |
| UnhealedWounds-Commu..> | 2018-06-20 18:06 | 185K | |
| Undercurrents Articl..> | 2018-04-24 03:34 | 8.1M | |
| Undercurrents2.ppt | 2018-04-24 03:34 | 552K | |
| Undercurrents2.pdf | 2018-04-24 03:34 | 1.4M | |
| Undercurrents.pdf | 2018-04-24 03:34 | 11K | |
| Undercurrent Workshe..> | 2018-04-24 03:34 | 400K | |
| Undercurrent Workshe..> | 2018-04-24 03:34 | 208K | |
| UndercurrentTherapyH..> | 2018-04-24 03:34 | 226K | |
| UndercurrentTherapyH..> | 2018-04-24 03:34 | 511K | |
| Truancy Contract.docx | 2018-04-24 03:34 | 16K | |
| Trifold Brochure - R..> | 2020-03-13 23:21 | 138K | |
| Trifold Brochure - R..> | 2020-03-13 23:21 | 189K | |
| Trifold Brochure - B..> | 2020-03-13 23:21 | 138K | |
| Trifold Brochure - B..> | 2020-03-13 23:21 | 190K | |
| Trifold Brochure - A..> | 2020-03-13 23:21 | 138K | |
| Trifold Brochure - A..> | 2020-03-13 23:21 | 191K | |
| TreeSlide.ppt | 2018-04-24 03:34 | 130K | |
| Tree Slide.ppt | 2018-04-24 03:34 | 130K | |
| Travel Request Info.doc | 2018-04-24 03:34 | 27K | |
| Trauma Feedback Loop..> | 2020-10-30 16:59 | 1.3M | |
| TransportabilityRE.doc | 2018-04-24 03:34 | 612K | |
| Transportability Che..> | 2018-04-24 03:34 | 612K | |
| TransportabilityChec..> | 2018-04-24 03:34 | 355K | |
| Training AgendaCo-fa..> | 2018-04-24 03:34 | 487K | |
| Training AgendaCo-fa..> | 2018-04-24 03:34 | 181K | |
| TopAnswerGameSpanish..> | 2018-04-24 03:34 | 23M | |
| Top Answer Game Card..> | 2018-04-24 03:34 | 409K | |
| Top Answer Game Card..> | 2018-04-24 03:34 | 310K | |
| TopAnswerGame.ppt | 2018-04-24 03:34 | 23M | |
| Tom_Robbins.jpg | 2018-04-24 03:34 | 2.2K | |
| Thumbs.db | 2018-04-24 03:34 | 667K | |
| Therapist Honor Code..> | 2018-04-24 03:34 | 145K | |
| The Window of Tolera..> | 2020-10-30 16:17 | 264K | |
| The Homework Lead Sh..> | 2020-10-30 16:18 | 239K | |
| The Decision Tree-Fi..> | 2020-10-30 16:18 | 213K | |
| Template Stress Char..> | 2018-04-24 03:34 | 194K | |
| Template Seed Tree.ppt | 2018-04-24 03:34 | 1.8M | |
| Template Feedback Lo..> | 2018-04-24 03:34 | 661K | |
| Teen Unpredictables.pdf | 2020-10-30 14:44 | 274K | |
| Teen Unpredictables.doc | 2018-04-24 03:34 | 320K | |
| Teen Unpredictables ..> | 2018-04-24 03:34 | 313K | |
| Teen Breakout Guide ..> | 2018-04-24 03:34 | 679K | |
| TXVQGradAgr.pdf | 2018-04-24 03:34 | 818K | |
| TXVQGradAgr.doc | 2018-04-24 03:34 | 95K | |
| TTAChapter12.pdf | 2018-04-24 03:34 | 31M | |
| TFPPM.pdf | 2018-04-24 03:34 | 2.3M | |
| TFPPM.doc | 2018-04-24 03:34 | 3.4M | |
| Susan.jpg | 2018-04-24 03:34 | 3.2K | |
| Supervisory Manual.pdf | 2018-04-24 03:34 | 2.9M | |
| SupervisionLtr.pdf | 2018-04-24 03:34 | 43K | |
| SupervisionLtr.doc | 2018-04-24 03:34 | 178K | |
| SuperBill.doc | 2018-04-24 03:34 | 35K | |
| SupProgNotes.pdf | 2018-04-24 03:34 | 27K | |
| SupProgNotes.doc | 2018-04-24 03:34 | 40K | |
| SupGuide.pdf | 2018-04-24 03:34 | 89K | |
| SupGuide.doc | 2018-04-24 03:34 | 148K | |
| Stephanie's Family P..> | 2018-04-24 03:34 | 2.4M | |
| StdGradReq.pdf | 2018-04-24 03:34 | 143K | |
| StdGradReq.doc | 2018-04-24 03:34 | 52K | |
| Standard Speaker Agr..> | 2018-04-24 03:34 | 162K | |
| Stages of Developmen..> | 2018-04-24 03:34 | 565K | |
| Stages of Developmen..> | 2018-04-24 03:34 | 74K | |
| Special Negotiator T..> | 2018-04-24 03:34 | 237K | |
| SpanishGroupPowerpoi..> | 2018-04-24 03:34 | 7.7M | |
| Souder.jpg | 2018-04-24 03:34 | 19K | |
| SolutionBasedSelling..> | 2018-04-24 03:34 | 127K | |
| SolutionBasedSelling..> | 2018-04-24 03:34 | 132K | |
| SmithTom.jpg | 2018-04-24 03:34 | 32K | |
| Smart Plan to manage..> | 2018-04-24 03:34 | 26K | |
| SkillsSeekSpanish.ppt | 2018-04-24 03:34 | 1.3M | |
| SkillsSeekGame.ppt | 2020-10-30 20:32 | 1.7M | |
| Sharon-A.png | 2018-04-24 03:34 | 18K | |
| Setting up Filezilla..> | 2018-04-24 03:34 | 3.2M | |
| SellsExtendedCV.pdf | 2018-04-24 03:34 | 263K | |
| SellsExtendedCV.doc | 2018-04-24 03:34 | 155K | |
| Self care plan devel..> | 2018-04-24 03:34 | 260K | |
| Self Care & Health C..> | 2018-04-24 03:34 | 58K | |
| Seed Definition Work..> | 2018-04-24 03:34 | 252K | |
| SeedDef.pdf | 2019-11-26 21:11 | 133K | |
| ScottPro.jpg | 2018-04-24 03:34 | 20K | |
| Scott.jpg | 2018-04-24 03:34 | 13K | |
| Scott-A.png | 2018-04-24 03:34 | 16K | |
| School Success Contr..> | 2018-04-24 03:34 | 41K | |
| Sample Training Agre..> | 2018-04-24 03:34 | 79K | |
| Sample Training Agre..> | 2018-04-24 03:34 | 38K | |
| SampleRewardsCalenda..> | 2018-04-24 03:34 | 48K | |
| SampleRewardsCalenda..> | 2018-04-24 03:34 | 83K | |
| Sample RE Budget1.pdf | 2018-04-24 03:34 | 410K | |
| SampleMovieNightQues..> | 2020-10-30 15:18 | 1.2M | |
| SampleMovieNightQues..> | 2018-04-24 03:34 | 31K | |
| Sample Feedback Loop..> | 2018-04-24 03:34 | 5.8M | |
| Sample Countermoves ..> | 2018-04-24 03:34 | 377K | |
| Sample Countermoves ..> | 2018-04-24 03:34 | 276K | |
| Sample Countermoves ..> | 2018-04-24 03:34 | 276K | |
| Sample Countermoves ..> | 2018-04-24 03:34 | 180K | |
| Sample Countermoves ..> | 2018-04-24 03:34 | 274K | |
| Sample Countermoves ..> | 2018-04-24 03:34 | 376K | |
| Sample Contracts.pdf | 2018-04-24 03:34 | 437K | |
| Sample Contracts (Sp..> | 2018-04-24 03:34 | 523K | |
| Sample Contract - Tr..> | 2018-04-24 03:34 | 319K | |
| Sample Contract - Tr..> | 2018-04-24 03:34 | 36K | |
| Sample Contract - Le..> | 2018-04-24 03:34 | 156K | |
| Sample Contract - Le..> | 2018-04-24 03:34 | 36K | |
| Sample Contract - Di..> | 2018-04-24 03:34 | 103K | |
| Sample Contract - Di..> | 2018-04-24 03:34 | 38K | |
| Sample Contract - Di..> | 2018-04-24 03:34 | 73K | |
| Sample Contract - Di..> | 2018-04-24 03:34 | 36K | |
| Sample Contract - Cu..> | 2018-04-24 03:34 | 97K | |
| Sample Contract - Cu..> | 2018-04-24 03:34 | 31K | |
| Sample Contract - Ch..> | 2018-04-24 03:34 | 85K | |
| Sample Contract - Ch..> | 2018-04-24 03:34 | 37K | |
| SampleCOEReportForm.xls | 2018-04-24 03:34 | 2.3M | |
| SampleCOEAgr.pdf | 2018-04-24 03:34 | 96K | |
| SampleCOEAgr.doc | 2018-04-24 03:34 | 196K | |
| Sample Aftercare Pla..> | 2018-04-24 03:34 | 67K | |
| Samp_Safety.pdf | 2018-04-24 03:34 | 36K | |
| Safety contract w RA..> | 2018-04-24 03:34 | 83K | |
| Safety and Closeness..> | 2018-04-24 03:34 | 1.3M | |
| Safety Stressor Ques..> | 2020-07-22 16:10 | 174K | |
| SFIStandardMutualNDA..> | 2018-04-24 03:34 | 77K | |
| SFI Retreat 0304 Inf..> | 2018-04-24 03:34 | 60K | |
| SFI Retreat 0304 Inf..> | 2018-04-24 03:34 | 224K | |
| SFIProcessArticle/ | 2018-04-24 03:34 | - | |
| SFI Order Form.xls | 2018-04-24 03:34 | 80K | |
| SFIMarketMenu.pdf | 2018-04-24 03:34 | 47K | |
| SFIMarketMenu.doc | 2018-04-24 03:34 | 131K | |
| SFI Logo1.JPG | 2018-04-24 03:34 | 18K | |
| SFI Logo.jpg | 2018-04-24 03:34 | 9.6K | |
| SFILogo.JPG | 2018-04-24 03:34 | 8.5K | |
| SFIDatabase.zip | 2018-04-24 03:34 | 4.0M | |
| SFI AND CLAYTON AGRE..> | 2018-04-24 03:34 | 196K | |
| SFI-VD-DVD4.JPG | 2018-04-24 03:34 | 3.3K | |
| SBurggrafPicture2.jpg | 2018-04-24 03:34 | 37K | |
| Rodman article.pdf | 2018-04-24 03:34 | 4.9M | |
| Retreat1005.pdf | 2018-04-24 03:34 | 96K | |
| Research Workplan te..> | 2018-04-24 03:34 | 82K | |
| Research Track.doc | 2018-04-24 03:34 | 1.5M | |
| Research Question De..> | 2018-04-24 03:34 | 1.7M | |
| ResearchProcedures.pdf | 2018-04-24 03:34 | 174K | |
| ResearchProcedures.doc | 2018-04-24 03:34 | 173K | |
| Research PlanTemplat..> | 2018-04-24 03:34 | 216K | |
| Research Introductio..> | 2018-04-24 03:34 | 1.7M | |
| Regional Centers Doc..> | 2018-04-24 03:34 | 267K | |
| Referral Marketing P..> | 2020-10-30 16:57 | 15M | |
| Reentry Intro Letter..> | 2018-04-24 03:34 | 89K | |
| Reentry Grid-Open Ca..> | 2018-04-24 03:34 | 360K | |
| Reducing Conduct Dis..> | 2018-04-24 03:34 | 291K | |
| RedFlagsChecklist.pdf | 2018-04-24 03:34 | 360K | |
| RedFlagsChecklist.doc | 2018-04-24 03:34 | 160K | |
| Readiness Scale Yout..> | 2018-04-24 03:34 | 87K | |
| Readiness Scale Yout..> | 2018-04-24 03:34 | 88K | |
| Readiness Scale Care..> | 2018-04-24 03:34 | 101K | |
| Readiness Scale Care..> | 2018-04-24 03:34 | 87K | |
| Rashmi-A.png | 2018-04-24 03:34 | 17K | |
| RPN Instructional Sh..> | 2018-04-24 03:34 | 609K | |
| RPN Instructional Sh..> | 2018-04-24 03:34 | 1.8M | |
| RPN Instructional Sh..> | 2018-04-24 03:34 | 1.8M | |
| RPN Instruction Shee..> | 2018-04-24 03:34 | 1.8M | |
| RIflowofcases.pdf | 2018-04-24 03:34 | 216K | |
| RIentrancetoexit.pdf | 2018-04-24 03:34 | 358K | |
| RIentrancetoexit.doc | 2018-04-24 03:34 | 77K | |
| REdFlagsChecklistSpa..> | 2018-04-24 03:34 | 361K | |
| RETherapist Position..> | 2018-04-24 03:34 | 64K | |
| REGFORM3.pdf | 2018-04-24 03:34 | 780K | |
| RE Budget Planner.xls | 2018-04-24 03:34 | 68K | |
| QuickGlanceStartup.pdf | 2018-04-24 03:34 | 244K | |
| QuickGlanceStartup.doc | 2018-04-24 03:34 | 281K | |
| Quick Facts Communit..> | 2018-04-24 03:34 | 756K | |
| Quick Facts - Reentr..> | 2018-04-24 03:34 | 955K | |
| PsychoNetArticle1204..> | 2018-04-24 03:34 | 34K | |
| PsychNet1204.pdf | 2018-04-24 03:34 | 66K | |
| Program Supply List ..> | 2018-04-24 03:34 | 551K | |
| Program Supply List ..> | 2018-04-24 03:34 | 561K | |
| Process Undercurrent..> | 2019-11-26 21:12 | 165K | |
| ProcessUndercurrentW..> | 2018-04-24 03:34 | 337K | |
| Process Undercurrent..> | 2018-04-24 03:34 | 450K | |
| Process Undercurrent..> | 2018-04-24 03:34 | 183K | |
| Procedures for Inter..> | 2018-04-24 03:34 | 637K | |
| Procedures for Inter..> | 2018-04-24 03:34 | 56K | |
| PreSessionPrepPhaseI..> | 2018-05-15 16:08 | 258K | |
| Posterboard-Disrespe..> | 2018-04-24 03:34 | 375K | |
| Posterboard-Aftercar..> | 2018-04-24 03:34 | 204K | |
| Positive Teen Report..> | 2020-10-30 15:16 | 428K | |
| Positive Teen Report..> | 2018-04-24 03:34 | 122K | |
| Positive Parent Repo..> | 2020-10-30 15:15 | 429K | |
| Positive Parent Repo..> | 2018-04-24 03:34 | 123K | |
| Positive Parent Repo..> | 2018-04-24 03:34 | 545K | |
| Position Description..> | 2018-04-24 03:34 | 222K | |
| Playbook Template.docx | 2018-04-24 03:34 | 14K | |
| ParentUnpredictables..> | 2020-10-30 14:40 | 277K | |
| ParentUnpredictables..> | 2018-04-24 03:34 | 321K | |
| Parent Unpredictable..> | 2018-04-24 03:34 | 349K | |
| PYOOCbook_SM.jpg | 2018-04-24 03:34 | 24K | |
| PYOOCbook_LG.jpg | 2018-04-24 03:34 | 64K | |
| PYOOCbookSPAN (Spani..> | 2018-04-24 03:34 | 14K | |
| PPG Expense Report F..> | 2018-04-24 03:34 | 42K | |
| PPG COENDA Rev 1013.pdf | 2018-04-24 03:34 | 64K | |
| POSITIVE TEEN REPORT..> | 2018-04-24 03:34 | 7.3K | |
| PLL Video Clips List..> | 2018-04-24 03:34 | 740K | |
| PLL Video Clips List..> | 2018-04-24 03:34 | 246K | |
| PLL Training Evaluat..> | 2018-04-24 03:34 | 134K | |
| PLL Training Evaluat..> | 2018-04-24 03:34 | 61K | |
| PLL Training Evaluat..> | 2018-04-24 03:34 | 131K | |
| PLL Training Evaluat..> | 2018-04-24 03:34 | 54K | |
| PLL Therapist Job De..> | 2018-04-24 03:34 | 63K | |
| PLLSupervisorPerfEva..> | 2018-04-24 03:34 | 83K | |
| PLL Supervisor Bench..> | 2018-04-24 03:34 | 73K | |
| PLLSupervisionMan.pdf | 2018-04-24 03:34 | 1.0M | |
| PLL Supervision Agen..> | 2018-04-24 03:34 | 806K | |
| PLL Supervision Agen..> | 2018-04-24 03:34 | 284K | |
| PLLStrategiesforTrau..> | 2018-04-24 03:34 | 465K | |
| PLL Strategies for T..> | 2018-04-24 03:34 | 466K | |
| PLL Resources.pdf | 2018-04-24 03:34 | 3.7M | |
| PLL Research Flow Ch..> | 2018-04-24 03:34 | 117K | |
| PLLReferences.pdf | 2018-04-24 03:34 | 31K | |
| PLLReferences.doc | 2018-04-24 03:34 | 180K | |
| PLL Re-Entry Service..> | 2018-04-24 03:34 | 366K | |
| PLLREvsATC.pdf | 2018-04-24 03:34 | 148K | |
| PLLREvsATC.doc | 2018-04-24 03:34 | 433K | |
| PLLProtocolChecklist..> | 2018-04-24 03:34 | 587K | |
| PLLPresentation.ppt | 2018-04-24 03:34 | 903K | |
| PLLOviewCat1.pdf | 2018-04-24 03:34 | 65K | |
| PLLOviewCat1.doc | 2018-04-24 03:34 | 791K | |
| PLLOview2.pdf | 2018-04-24 03:34 | 98K | |
| PLLOview2.doc | 2018-04-24 03:34 | 161K | |
| PLLOview.pdf | 2018-04-24 03:34 | 300K | |
| PLLOView.doc | 2018-04-24 03:34 | 172K | |
| PLLMotivationalIntak..> | 2018-04-24 03:34 | 596K | |
| PLLMotivationalIntak..> | 2018-04-24 03:34 | 187K | |
| PLLModel.pdf | 2018-04-24 03:34 | 65K | |
| PLL Model.pdf | 2018-04-24 03:34 | 187K | |
| PLLModel.doc | 2018-04-24 03:34 | 50K | |
| PLL Model.doc | 2018-04-24 03:34 | 149K | |
| PLL Logic Model Rese..> | 2018-04-24 03:34 | 213K | |
| PLL Logic Model Rese..> | 2018-04-24 03:34 | 570K | |
| PLL Logic Model.pdf | 2021-09-05 13:28 | 337K | |
| PLLFlyerSample.pdf | 2018-04-24 03:34 | 71K | |
| PLLFlyerSample.doc | 2018-04-24 03:34 | 76K | |
| PLLFEvsEC.pdf | 2018-04-24 03:34 | 46K | |
| PLLFEvsEC.doc | 2018-04-24 03:34 | 56K | |
| PLL Expense Report F..> | 2018-04-24 03:34 | 42K | |
| PLL Exit Interview F..> | 2018-04-24 03:34 | 439K | |
| PLL Exit Interview F..> | 2018-04-24 03:34 | 126K | |
| PLL Exit Interview F..> | 2018-04-24 03:34 | 142K | |
| PLL Dashboard User M..> | 2020-10-30 14:55 | 1.6M | |
| PLL Common Definitio..> | 2020-03-13 23:14 | 167K | |
| PLLCoachingHandbookF..> | 2018-04-24 03:34 | 1.4M | |
| PLLCoachingHandbookF..> | 2018-04-24 03:34 | 2.1M | |
| PLLCoachingHandbookE..> | 2018-04-24 03:34 | 1.8M | |
| PLLCoachingHandbookE..> | 2018-04-24 03:34 | 3.0M | |
| PLLCoachingHandbook.pdf | 2018-04-24 03:34 | 273K | |
| PLLCoachingHandbook.doc | 2018-04-24 03:34 | 369K | |
| PLL Co-facilitator I..> | 2018-04-24 03:34 | 47K | |
| PLLClientPerfSumCLOS..> | 2018-04-24 03:34 | 401K | |
| PLLClientPerfSumCLOS..> | 2018-04-24 03:34 | 194K | |
| PLLClientPerfSum.pdf | 2018-04-24 03:34 | 409K | |
| PLLClientPerfSum.doc | 2018-04-24 03:34 | 218K | |
| PLLCertPlanner.pdf | 2018-04-24 03:34 | 246K | |
| PLLCertPlanner.doc | 2018-04-24 03:34 | 1.9M | |
| PLLCertAgr.pdf | 2018-04-24 03:34 | 29K | |
| PLLCasenoteBlank.pdf | 2018-04-24 03:34 | 369K | |
| PLLCasenoteBlank.doc | 2018-04-24 03:34 | 162K | |
| PLL Case Manager Int..> | 2018-04-24 03:34 | 74K | |
| PLL Case Manager Int..> | 2018-04-24 03:34 | 51K | |
| PLL Case Management ..> | 2018-05-16 16:12 | 2.9M | |
| PLL Candidate Interv..> | 2018-04-24 03:34 | 66K | |
| PLLBrochureSample.pdf | 2018-04-24 03:34 | 85K | |
| PLLBrochureSample.doc | 2018-04-24 03:34 | 104K | |
| PLLBrochure.pdf | 2018-04-24 03:34 | 3.9M | |
| PLL Assessments Cove..> | 2020-03-13 23:34 | 179K | |
| PLL Assessments Cove..> | 2018-04-24 03:34 | 549K | |
| PLL.JPG | 2018-04-24 03:34 | 13K | |
| PLL-Model-Overview.mp4 | 2021-02-26 16:32 | 254M | |
| PLL-Dashboard.mp4 | 2021-02-26 15:43 | 251M | |
| PICJarticle.pdf | 2018-04-24 03:34 | 151K | |
| PARCOURBROCHURE.pdf | 2018-04-24 03:34 | 421K | |
| OviewCOELicense.pdf | 2018-04-24 03:34 | 42K | |
| OviewCOELicense.doc | 2018-04-24 03:34 | 206K | |
| OviewCOEAgrRE.pdf | 2018-04-24 03:34 | 245K | |
| OviewCOEAgrRE.doc | 2018-04-24 03:34 | 181K | |
| OviewCOEAgrFE.pdf-old | 2018-04-24 03:34 | 56K | |
| OviewCOEAgrFE.pdf | 2018-04-24 03:34 | 136K | |
| OviewCOEAgrFE.doc | 2018-04-24 03:34 | 225K | |
| OviewCOEAgrEC.pdf-old | 2018-04-24 03:34 | 56K | |
| OviewCOEAgrEC.pdf | 2018-04-24 03:34 | 242K | |
| OviewCOEAgrEC.doc | 2018-04-24 03:34 | 179K | |
| OpenCaseLog.xls | 2018-04-24 03:34 | 97K | |
| Ohio Withholding For..> | 2018-04-24 03:34 | 38K | |
| OJJDP1.pdf | 2018-04-24 03:34 | 227K | |
| OJJDP.doc | 2018-04-24 03:34 | 139K | |
| No drug or alcohol u..> | 2018-04-24 03:34 | 35K | |
| No Violence Contract..> | 2018-04-24 03:34 | 39K | |
| No Stealing Contract..> | 2018-04-24 03:34 | 285K | |
| No Aggression Contra..> | 2018-04-24 03:34 | 1.0M | |
| NickAntitheftbattlep..> | 2018-04-24 03:34 | 3.9M | |
| Nick's Graduation Pa..> | 2018-04-24 03:34 | 565K | |
| Nick's Graduation Pa..> | 2018-04-24 03:34 | 160K | |
| Nick's Graduation Pa..> | 2018-04-24 03:34 | 603K | |
| Nick's Graduation Pa..> | 2018-04-24 03:34 | 180K | |
| Nick's Graduation Pa..> | 2018-04-24 03:34 | 160K | |
| Nick's Graduation Pa..> | 2018-04-24 03:34 | 180K | |
| Newsletter 0404a.pdf | 2018-04-24 03:34 | 1.6M | |
| NewsLtr View.pdf | 2018-04-24 03:34 | 442K | |
| NewsLtr Print.pdf | 2018-04-24 03:34 | 2.5M | |
| NewsLtr0804.pdf | 2018-04-24 03:34 | 66K | |
| NewsLtr0404a.pdf | 2018-04-24 03:34 | 1.6M | |
| NewsLtr0404.pdf | 2018-04-24 03:34 | 1.6M | |
| NewsLtr0105.pdf | 2018-04-24 03:34 | 64K | |
| NewsLtr0104View.pdf | 2018-04-24 03:34 | 182K | |
| NewsLtr0104Print.pdf | 2018-04-24 03:34 | 451K | |
| Negotiator Technique..> | 2018-04-24 03:34 | 213K | |
| Negotiator Technique..> | 2018-04-24 03:34 | 102K | |
| NREPPSummary.pdf | 2018-08-30 16:55 | 221K | |
| NCJFCJKeynote.pdf | 2018-04-24 03:34 | 1.9M | |
| NCJFCJHandout.pdf | 2018-04-24 03:34 | 764K | |
| Movies for Wound Und..> | 2018-04-24 03:34 | 1.3M | |
| Monti-A.png | 2018-04-24 03:34 | 19K | |
| Model_PosterSm.jpg | 2018-04-24 03:34 | 2.4K | |
| Model_Poster.jpg | 2018-04-24 03:34 | 14K | |
| Model Poster.jpg | 2018-04-24 03:34 | 14K | |
| MinionPro-Bold.otf | 2021-04-16 14:20 | 213K | |
| Michael-A.png | 2018-04-24 03:34 | 17K | |
| Main Principles of A..> | 2018-04-24 03:34 | 57K | |
| MSTCompare.pdf | 2018-04-24 03:34 | 36K | |
| MSTCompare.doc | 2018-04-24 03:34 | 184K | |
| MIGradAgr.pdf | 2018-04-24 03:34 | 725K | |
| MIGradAgr.doc | 2018-04-24 03:34 | 86K | |
| MIFlowofCases.pdf | 2018-04-24 03:34 | 474K | |
| MIEntrancetoExit.pdf | 2018-04-24 03:34 | 195K | |
| MIEntrancetoExit.doc | 2018-04-24 03:34 | 66K | |
| M002B.pdf | 2018-04-24 03:34 | 317K | |
| M002A.pdf | 2018-04-24 03:34 | 128K | |
| Lynn-A.png | 2018-04-24 03:34 | 20K | |
| Level 2 MI Script.doc | 2018-04-24 03:34 | 564K | |
| Level 1 MI Phone Scr..> | 2018-04-24 03:34 | 148K | |
| Level 1 MI Phone Scr..> | 2018-04-24 03:34 | 187K | |
| Leaving without perm..> | 2018-04-24 03:34 | 940K | |
| L2Oheads.pptx | 2020-03-06 16:22 | 5.4M | |
| L1Kit.jpg | 2018-04-24 03:34 | 14K | |
| Kinniry Family Reuni..> | 2018-06-25 20:46 | 3.6G | |
| JournalJuvJusticeart..> | 2018-04-24 03:34 | 1.5M | |
| John_Walker.jpg | 2018-04-24 03:34 | 2.8K | |
| John_Robbins.jpg | 2018-04-24 03:34 | 3.6K | |
| John-A.png | 2018-04-24 03:34 | 15K | |
| Jenny-A.png | 2018-04-24 03:34 | 16K | |
| Jeanne0505.jpg | 2018-04-24 03:34 | 42K | |
| Jeanne.jpg | 2018-04-24 03:34 | 18K | |
| Jalanie.jpg | 2018-04-24 03:34 | 4.0K | |
| Interview Score Summ..> | 2018-04-24 03:34 | 97K | |
| Interview Questions ..> | 2020-03-13 23:22 | 390K | |
| Internet Accountabil..> | 2018-04-24 03:34 | 32K | |
| Internal Measures Sc..> | 2018-04-24 03:34 | 35K | |
| Instructions for Dow..> | 2018-04-24 03:34 | 3.4M | |
| Informed Consent for..> | 2020-10-30 16:39 | 278K | |
| Inclusionary-Exclusi..> | 2020-10-30 19:58 | 4.9M | |
| Inappropriate Sexual..> | 2018-04-24 03:34 | 38K | |
| Idaho Monograph 2010..> | 2018-04-24 03:34 | 1.3M | |
| Icebreaker Games.doc | 2018-04-24 03:34 | 33K | |
| ID CMH Journal Artic..> | 2018-04-24 03:34 | 672K | |
| I-9 Form.pdf | 2018-04-24 03:34 | 379K | |
| Hygiene Contract.ppt | 2018-04-24 03:34 | 145K | |
| Hybrid Contract.docx | 2018-04-24 03:34 | 15K | |
| HostAgencyKitPLLCert..> | 2018-04-24 03:34 | 54K | |
| HostAgencyKitPLLCert..> | 2018-04-24 03:34 | 68K | |
| HostAgencyKitFTCert.pdf | 2018-04-24 03:34 | 68K | |
| HostAgencyKitFTCert.doc | 2018-04-24 03:34 | 125K | |
| HostAgencyKitExtWS.pdf | 2018-04-24 03:34 | 63K | |
| HostAgencyKitExtWS.doc | 2018-04-24 03:34 | 119K | |
| Hope's Family Plan.ppt | 2018-04-24 03:34 | 3.1M | |
| Hire_A_Trainer.pdf | 2018-04-24 03:34 | 268K | |
| Hillen, Karla 1.jpg | 2018-04-24 03:34 | 205K | |
| Healing Phrases.pdf | 2020-10-30 20:05 | 196K | |
| Healing Phrases.doc | 2018-04-24 03:34 | 126K | |
| Healing Phrases (Spa..> | 2018-04-24 03:34 | 447K | |
| HandoutsUndercurrent..> | 2018-04-24 03:34 | 168K | |
| HandoutsPsychNet1204..> | 2018-04-24 03:34 | 66K | |
| HandoutTreatingWS.pdf | 2018-04-24 03:34 | 903K | |
| Handout Teen Button ..> | 2018-04-24 03:34 | 256K | |
| Handout Teen Button ..> | 2018-04-24 03:34 | 63K | |
| Handout Parent & Vil..> | 2018-04-24 03:34 | 268K | |
| Handout Parent & Vil..> | 2018-04-24 03:34 | 64K | |
| HandoutFTCert.pdf | 2018-04-24 03:34 | 503K | |
| HandoutFTCert.doc | 2018-04-24 03:34 | 699K | |
| HandoutEmpoweringPar..> | 2018-04-24 03:34 | 904K | |
| HandoutEmpoweringPar..> | 2018-04-24 03:34 | 746K | |
| Handout Countermoves..> | 2018-04-24 03:34 | 32K | |
| Handout Countermoves..> | 2018-04-24 03:34 | 17K | |
| Handout Countermoves..> | 2018-04-24 03:34 | 216K | |
| Handout Countermoves..> | 2018-04-24 03:34 | 65K | |
| Handout Countermoves..> | 2018-04-24 03:34 | 32K | |
| HIPAARelease.doc | 2018-04-24 03:34 | 33K | |
| Guilford.jpg | 2018-04-24 03:34 | 16K | |
| GuidetoInterpretingA..> | 2020-03-13 23:36 | 529K | |
| GrpCoachSeq.pdf | 2018-04-24 03:34 | 187K | |
| Grouppowerpoint1.ppt | 2018-04-24 03:34 | 1.7M | |
| Group Rules.pdf | 2018-04-24 03:34 | 510K | |
| Group Rules.doc | 2018-04-24 03:34 | 124K | |
| Group Rules (Spanish..> | 2018-04-24 03:34 | 194K | |
| Group Rules (Spanish..> | 2018-04-24 03:34 | 132K | |
| Group Manual Spanish..> | 2018-04-24 03:34 | 203K | |
| GroupIntermediateIPR..> | 2018-04-24 03:34 | 619K | |
| GroupIntermediateIPR..> | 2018-04-24 03:34 | 323K | |
| Group Flip Chart Pre..> | 2020-10-30 19:32 | 497K | |
| GroupFidelityLong Fo..> | 2018-04-24 03:34 | 425K | |
| Group Fidelity Check..> | 2018-04-24 03:34 | 425K | |
| Group Fidelity Check..> | 2018-04-24 03:34 | 433K | |
| Group Fidelity Check..> | 2018-04-24 03:34 | 330K | |
| GroupFidelity(LongFo..> | 2020-03-13 23:37 | 264K | |
| GroupContentIPR.pdf | 2018-04-24 03:34 | 962K | |
| GroupContentIPR.doc | 2018-04-24 03:34 | 413K | |
| GroupAttendanceSheet..> | 2018-04-24 03:34 | 41K | |
| GroupAdvancedIPR.pdf | 2018-04-24 03:34 | 434K | |
| GroupAdvancedIPR.doc | 2018-04-24 03:34 | 176K | |
| GraduationPacketJole..> | 2018-04-24 03:34 | 2.1M | |
| Graduation Packet Da..> | 2018-04-24 03:34 | 2.4M | |
| GraduationPacketCull..> | 2018-04-24 03:34 | 7.3M | |
| GradAgrR.pdf | 2018-04-24 03:34 | 680K | |
| GradAgrR.doc | 2018-04-24 03:34 | 157K | |
| GradAgrR(Sp).pdf | 2018-04-24 03:34 | 864K | |
| GradAgrR(Sp).doc | 2018-04-24 03:34 | 200K | |
| GradAgrP.pdf | 2018-04-24 03:34 | 279K | |
| GradAgrP.doc | 2018-04-24 03:34 | 139K | |
| GradAgrD.pdf | 2018-04-24 03:34 | 261K | |
| GradAgrD.doc | 2018-04-24 03:34 | 132K | |
| GradAgr(All)sp.pdf | 2018-04-24 03:34 | 309K | |
| GradAgr(All).pdf | 2020-02-18 21:21 | 210K | |
| GradAgr(All).doc | 2018-04-24 03:34 | 145K | |
| GingerWard.jpg | 2018-04-24 03:34 | 2.6K | |
| Ginger-A.png | 2018-04-24 03:34 | 15K | |
| GTProtocolCheck.pdf | 2018-04-24 03:34 | 148K | |
| GTProtocolCheck.doc | 2018-04-24 03:34 | 562K | |
| GTFidelityCheck.pdf | 2018-04-24 03:34 | 504K | |
| GOPLL_BookCover (Spa..> | 2018-04-24 03:34 | 1.3M | |
| GLindsey0304.JPG | 2018-04-24 03:34 | 63K | |
| FreeConferenceCall.pdf | 2018-04-24 03:34 | 25K | |
| FreeConferenceCall.htm | 2018-04-24 03:34 | 19K | |
| FreeConferenceCall.doc | 2018-04-24 03:34 | 51K | |
| Final Research Plan ..> | 2018-04-24 03:34 | 1.7M | |
| Family Therapy Coach..> | 2018-04-24 03:34 | 2.2M | |
| Family Therapy Coach..> | 2018-04-24 03:34 | 1.3M | |
| FamilyProcessArticle..> | 2018-04-24 03:34 | 139K | |
| Family Plan Template..> | 2020-10-30 19:55 | 3.9M | |
| Family Coaching Ther..> | 2018-04-24 03:34 | 460K | |
| FTTrackForm.pdf | 2018-04-24 03:34 | 115K | |
| FTTrackForm.doc | 2018-04-24 03:34 | 266K | |
| FTSuppReading.pdf | 2018-04-24 03:34 | 38K | |
| FTSuppReading.doc | 2018-04-24 03:34 | 83K | |
| FTSupervisionMan.pdf | 2018-04-24 03:34 | 317K | |
| FTSupervisionMan.doc | 2018-04-24 03:34 | 444K | |
| FTCertPlanner.pdf | 2018-04-24 03:34 | 276K | |
| FTCertPlanner.doc | 2018-04-24 03:34 | 1.6M | |
| FTCertAgr.pdf | 2018-04-24 03:34 | 28K | |
| FST Trauma Feedback ..> | 2020-10-30 17:05 | 1.3M | |
| FACES espanol.pdf | 2018-04-24 03:34 | 439K | |
| FACES IV.pdf | 2018-04-24 03:34 | 130K | |
| Evaluability Assessm..> | 2018-04-24 03:34 | 1.7M | |
| Evaluability Assessm..> | 2018-04-24 03:34 | 1.5M | |
| EvalFormPLLCert.pdf | 2018-04-24 03:34 | 42K | |
| EvalFormPLLCert.doc | 2018-04-24 03:34 | 33K | |
| EvalFormFTCert.pdf | 2018-04-24 03:34 | 41K | |
| EvalFormFTCert.doc | 2018-04-24 03:34 | 32K | |
| EvalFormExtWS.pdf | 2018-04-24 03:34 | 28K | |
| Ellen-A.png | 2018-04-24 03:34 | 18K | |
| EcomapSpanish.pdf | 2018-04-24 03:34 | 367K | |
| Ecomap Instructions...> | 2020-10-30 15:57 | 585K | |
| Disrespect Contract.pdf | 2018-04-24 03:34 | 299K | |
| Dialog-Competition.pdf | 2018-04-24 03:34 | 73K | |
| Dialog-Competition.doc | 2018-04-24 03:34 | 56K | |
| Desk Reference for A..> | 2018-04-24 03:34 | 945K | |
| Desk Reference for A..> | 2020-03-13 23:32 | 433K | |
| Desk Reference for A..> | 2018-04-24 03:34 | 287K | |
| Desk Reference for A..> | 2018-04-24 03:34 | 298K | |
| DerailingMovesforTee..> | 2018-04-24 03:34 | 231K | |
| DerailingMovesforTee..> | 2018-04-24 03:34 | 147K | |
| Derailing Moves Unhe..> | 2018-04-24 03:34 | 297K | |
| Derailing Moves Unhe..> | 2018-04-24 03:34 | 176K | |
| Derailing Moves Rule..> | 2018-04-24 03:34 | 216K | |
| Derailing Moves Rule..> | 2018-04-24 03:34 | 146K | |
| Derailing Moves Role..> | 2018-04-24 03:34 | 198K | |
| Derailing Moves Role..> | 2018-04-24 03:34 | 146K | |
| Derailing Moves 3.pdf | 2018-04-24 03:34 | 227K | |
| Derailing Moves 3.doc | 2018-04-24 03:34 | 169K | |
| Derailing Moves 2.pdf | 2018-04-24 03:34 | 274K | |
| Derailing Moves 2.doc | 2018-04-24 03:34 | 145K | |
| Derailing Moves 1.pdf | 2018-04-24 03:34 | 274K | |
| Derailing Moves 1.doc | 2018-04-24 03:34 | 145K | |
| Demickos Family Plan..> | 2018-04-24 03:34 | 2.2M | |
| Data Collection Plan..> | 2018-04-24 03:34 | 64K | |
| DashboardSampleJune2..> | 2018-04-24 03:34 | 771K | |
| Dashboard Data and R..> | 2018-04-24 03:34 | 69K | |
| Dashboard Data and R..> | 2018-04-24 03:34 | 96K | |
| Darel's Re-Integrati..> | 2018-04-24 03:34 | 2.1M | |
| Countermoves sheet f..> | 2018-04-24 03:34 | 16K | |
| Counselor/ | 2018-04-24 03:34 | - | |
| CorrectionsTodayArti..> | 2018-04-24 03:34 | 361K | |
| Corrections Today.pdf | 2018-04-24 03:34 | 175K | |
| Copy of SFIDatabase.zip | 2018-04-24 03:34 | 4.0M | |
| Contract for Safety-..> | 2018-04-24 03:34 | 32K | |
| ContractTemplates.pdf | 2018-04-24 03:34 | 1.4M | |
| ContractTemplates.doc | 2018-04-24 03:34 | 816K | |
| Contract Template.docx | 2018-04-24 03:34 | 22K | |
| Contract Template(Sp..> | 2018-04-24 03:34 | 22K | |
| Consistency Pitfalls..> | 2018-04-24 03:34 | 629K | |
| Consistency Pitfalls..> | 2018-04-24 03:34 | 528K | |
| Consistency Pitfalls..> | 2018-04-24 03:34 | 221K | |
| Comparison of Core P..> | 2018-04-24 03:34 | 112K | |
| Coaching Therapy Man..> | 2018-04-24 03:34 | 1.1M | |
| CoachingIntermediate..> | 2018-04-24 03:34 | 501K | |
| CoachingIntermediate..> | 2018-04-24 03:34 | 234K | |
| CoachingContentIPR.pdf | 2018-04-24 03:34 | 698K | |
| CoachingContentIPR.doc | 2018-04-24 03:34 | 276K | |
| Coaching Cliff Notes..> | 2018-04-24 03:34 | 881K | |
| CoachingAdvancedIPR.pdf | 2018-04-24 03:34 | 432K | |
| CoachingAdvancedIPR.doc | 2018-04-24 03:34 | 148K | |
| CoachHelp12.pdf | 2018-04-24 03:34 | 20K | |
| CoachHelp11.pdf | 2018-04-24 03:34 | 20K | |
| CoachHelp10.pdf | 2018-04-24 03:34 | 20K | |
| CoachHelp9.pdf | 2018-04-24 03:34 | 20K | |
| CoachHelp8.pdf | 2018-04-24 03:34 | 262K | |
| CoachHelp7.pdf | 2018-04-24 03:34 | 108K | |
| CoachHelp6.pdf | 2018-04-24 03:34 | 36K | |
| CoachHelp5.pdf | 2018-04-24 03:34 | 35K | |
| CoachHelp4.pdf | 2018-04-24 03:34 | 31K | |
| CoachHelp3.pdf | 2018-04-24 03:34 | 85K | |
| CoachHelp2.pdf | 2018-04-24 03:34 | 63K | |
| CoachHelp1.pdf | 2018-04-24 03:34 | 25K | |
| CoFacilitatorScoreSu..> | 2018-04-24 03:34 | 62K | |
| Clinician Performanc..> | 2018-04-24 03:34 | 443K | |
| Clinician Performanc..> | 2018-04-24 03:34 | 553K | |
| Classic Derailing Mo..> | 2018-04-24 03:34 | 297K | |
| Classic Derailing Mo..> | 2018-04-24 03:34 | 216K | |
| ClassicDerailingMove..> | 2018-04-24 03:34 | 198K | |
| Classic Contracts.pdf | 2018-04-24 03:34 | 1.4M | |
| Classic Contracts.doc | 2018-04-24 03:34 | 816K | |
| ChristianMoore50.jpg | 2018-04-24 03:34 | 3.7K | |
| ChristianMoore.jpg | 2018-04-24 03:34 | 12K | |
| Chores with multiple..> | 2018-04-24 03:34 | 971K | |
| ChampaignFinalReport..> | 2018-04-24 03:34 | 1.2M | |
| ChampaignFinal Repor..> | 2018-04-24 03:34 | 1.2M | |
| CertTrainingPriceLis..> | 2018-04-24 03:34 | 27K | |
| CertChecklist.xls | 2018-04-24 03:34 | 42K | |
| Cat3Pricing.xls | 2018-04-24 03:34 | 25K | |
| Cat2SupervisionInfo.pdf | 2018-04-24 03:34 | 34K | |
| Case Manager Perform..> | 2018-04-24 03:34 | 508K | |
| Case Manager Perform..> | 2018-04-24 03:34 | 572K | |
| Case Manager Job Des..> | 2018-04-24 03:34 | 64K | |
| Carnival.pdf | 2018-04-24 03:34 | 262K | |
| Calendar.htm | 2018-04-24 03:34 | 9.2K | |
| COE pro forma.xls | 2018-04-24 03:34 | 73K | |
| COEWeeklyReport.doc | 2018-04-24 03:34 | 94K | |
| COETrainingKit.pdf | 2018-04-24 03:34 | 74K | |
| COETrainingKit.doc | 2018-04-24 03:34 | 130K | |
| COESignPortrait.pdf | 2018-04-24 03:34 | 715K | |
| COESignPortrait.eps | 2018-04-24 03:34 | 471K | |
| COESignLandscape.pdf | 2018-04-24 03:34 | 709K | |
| COESignLandscape.eps | 2018-04-24 03:34 | 495K | |
| COE Shutdown Checkli..> | 2018-04-24 03:34 | 163K | |
| COE Shutdown Checkli..> | 2018-04-24 03:34 | 151K | |
| COEReportForm.xls | 2018-04-24 03:34 | 392K | |
| COEReportCard.pdf | 2018-04-24 03:34 | 939K | |
| COEReportCard.doc | 2018-04-24 03:34 | 1.5M | |
| COE Report (Master).xls | 2018-04-24 03:34 | 1.3M | |
| COE Quarterly Review..> | 2018-04-24 03:34 | 1.2M | |
| COE Quarterly Review..> | 2018-04-24 03:34 | 2.4M | |
| COEPriceList.xls | 2018-04-24 03:34 | 24K | |
| COE Overview.pdf | 2018-04-24 03:34 | 79K | |
| COE Overview.doc | 2018-04-24 03:34 | 189K | |
| COEOpsMan.pdf | 2018-04-24 03:34 | 316K | |
| COEOpsMan.doc | 2018-04-24 03:34 | 1.7M | |
| COENDA.pdf | 2018-04-24 03:34 | 56K | |
| COECertAgenda.pdf | 2018-04-24 03:34 | 738K | |
| COECertAgenda.doc | 2018-04-24 03:34 | 242K | |
| COE Benchmarks Form.pdf | 2018-04-24 03:34 | 531K | |
| COE Benchmarks Form.doc | 2018-04-24 03:34 | 55K | |
| COE Benchmarks.pdf | 2018-04-24 03:34 | 660K | |
| COEBenchmarks.doc | 2018-04-24 03:34 | 88K | |
| COE Benchmarks.doc | 2018-04-24 03:34 | 63K | |
| CMIPLL0506.pdf | 2018-04-24 03:34 | 2.0M | |
| CMIPLL0306.pdf | 2018-04-24 03:34 | 4.9M | |
| CMIPLL0305.pdf | 2018-04-24 03:34 | 4.9M | |
| CLAYTONwBWLComments.rtf | 2018-04-24 03:34 | 196K | |
| CEUInfo.pdf | 2018-04-24 03:34 | 239K | |
| CEUInfo.doc | 2018-04-24 03:34 | 1.7M | |
| CEUCertificatePLLSOC..> | 2018-04-24 03:34 | 115K | |
| CEUCertificatePLLSOC..> | 2018-04-24 03:34 | 127K | |
| CEUCertificatePLLLev..> | 2018-04-24 03:34 | 44K | |
| CEUCertificatePLLLev..> | 2018-04-24 03:34 | 123K | |
| CEUCertificatePLLCer..> | 2018-04-24 03:34 | 117K | |
| CEUCertificatePLLCer..> | 2018-04-24 03:34 | 126K | |
| CEUCertificatePLLCer..> | 2018-04-24 03:34 | 127K | |
| CEUCertificatePLLCer..> | 2018-04-24 03:34 | 126K | |
| CEUCertificatePLLCer..> | 2018-04-24 03:34 | 126K | |
| CEUCertificateFTCert..> | 2018-04-24 03:34 | 43K | |
| CEUCertificateFTCert..> | 2018-04-24 03:34 | 123K | |
| CEUCertificateExtWS.pdf | 2018-04-24 03:34 | 35K | |
| CEUCertificateExtWS.doc | 2018-04-24 03:34 | 31K | |
| CEUCertificate-Panel..> | 2018-04-24 03:34 | 360K | |
| CEU Certificate-Audi..> | 2018-04-24 03:34 | 125K | |
| CBCL.pdf | 2018-04-24 03:34 | 40K | |
| CBATroster.doc | 2018-04-24 03:34 | 35K | |
| CBATletter.doc | 2018-04-24 03:34 | 84K | |
| CBAT Training Phases..> | 2018-04-24 03:34 | 654K | |
| CBAT Timeline of Ree..> | 2018-04-24 03:34 | 191K | |
| CBAT Timeline of ATP..> | 2018-04-24 03:34 | 184K | |
| CBAT Team Template.docx | 2018-04-24 03:34 | 78K | |
| CBAT Team Template ...> | 2020-10-30 15:56 | 77K | |
| CBAT Team Sample.docx | 2020-10-30 15:56 | 77K | |
| CBAT Team Electronic..> | 2018-04-24 03:34 | 93K | |
| CBAT Supervision Age..> | 2018-04-24 03:34 | 662K | |
| CBAT Supervision Age..> | 2018-04-24 03:34 | 279K | |
| CBAT Supervision Age..> | 2018-04-24 03:34 | 282K | |
| CBAT Overview.pptx | 2018-04-24 03:34 | 276K | |
| CBAT Agenda-Case Man..> | 2020-10-30 15:40 | 408K | |
| CBAT Agenda-Attendee..> | 2020-10-30 15:41 | 116K | |
| CA4D0504Brochure.pdf | 2018-04-24 03:34 | 186K | |
| Button Buster Flashc..> | 2020-10-30 15:17 | 272K | |
| Button Buster Flashc..> | 2018-04-24 03:34 | 275K | |
| Button Buster Flashc..> | 2018-04-24 03:34 | 511K | |
| Bruce's Red Flags Ch..> | 2018-04-24 03:34 | 361K | |
| Bruce's Family Plan...> | 2020-11-13 15:44 | 1.3M | |
| Bruce's Family Plan.ppt | 2020-10-30 20:58 | 3.9M | |
| Bruce's Family Plan ..> | 2018-04-24 03:34 | 1.3M | |
| Bob-A.png | 2018-04-24 03:34 | 16K | |
| BlueandRedStates.doc | 2018-04-24 03:34 | 2.8M | |
| Blank Ecomap.pptx | 2018-04-24 03:34 | 71K | |
| BestofStrategies.pdf | 2020-03-13 23:40 | 160K | |
| BestOfStrategies.pdf | 2020-10-30 15:11 | 160K | |
| BestOfStrategies.doc | 2018-04-24 03:34 | 557K | |
| Basic Dietary Guidel..> | 2020-10-30 16:15 | 195K | |
| Barry0404b.JPG | 2018-04-24 03:34 | 26K | |
| Barry0404a.JPG | 2018-04-24 03:34 | 26K | |
| Barry0305.jpg | 2018-04-24 03:34 | 144K | |
| Barry-A.png | 2018-04-24 03:34 | 16K | |
| AustinBrochure.pdf | 2018-04-24 03:34 | 2.8M | |
| Attrition Training A..> | 2018-04-24 03:34 | 341K | |
| Attrition Training A..> | 2018-04-24 03:34 | 762K | |
| AngerManagementAgree..> | 2018-04-24 03:34 | 32K | |
| Amedco.pdf | 2018-04-24 03:34 | 265K | |
| AgendaTreating2D.pdf | 2018-04-24 03:34 | 52K | |
| AgendaTreating2D.doc | 2018-04-24 03:34 | 109K | |
| AgendaTreating1D.pdf | 2018-04-24 03:34 | 34K | |
| AgendaTreating1D.doc | 2018-04-24 03:34 | 94K | |
| AgendaEmpoweringPare..> | 2018-04-24 03:34 | 20K | |
| AgendaEmpoweringPare..> | 2018-04-24 03:34 | 85K | |
| AgendaEmpowering1D.pdf | 2018-04-24 03:34 | 33K | |
| AgendaEmpowering1D.doc | 2018-04-24 03:34 | 94K | |
| Age Regression Cards..> | 2020-10-30 15:26 | 222K | |
| Age Regression Cards..> | 2018-04-24 03:34 | 157K | |
| Age Regression Cards..> | 2018-04-24 03:34 | 624K | |
| AftercarePlanSpanish..> | 2018-04-24 03:34 | 1.0M | |
| ATP Intro Letter.docx | 2018-04-24 03:34 | 87K | |
| ATP Grid-Open Cases.pdf | 2018-04-24 03:34 | 268K | |
| AKProcedures for Int..> | 2018-04-24 03:34 | 173K | |
| 2009-10 Evaluation R..> | 2018-04-24 03:34 | 969K | |
| 2009-10 CAR Report.pdf | 2018-04-24 03:34 | 1.6M | |
| 2008-09 CAR Report.pdf | 2018-04-24 03:34 | 321K | |
| 37.jpg | 2018-04-24 03:34 | 14K | |
| 13-Template Wound Co..> | 2018-04-24 03:34 | 960K | |
| 12-Template Lie Mons..> | 2018-04-24 03:34 | 945K | |
| 11-Template Wound Pl..> | 2018-04-24 03:34 | 949K | |
| 10StepstoEngage.doc | 2018-04-24 03:34 | 136K | |
| 10-Template Red Flag..> | 2018-04-24 03:34 | 158K | |
| 9-Template Phase IV ..> | 2018-04-24 03:34 | 186K | |
| 8b-Template ATP Trea..> | 2018-04-24 03:34 | 952K | |
| 8a-Template Aftercar..> | 2018-04-24 03:34 | 1.0M | |
| 8-High Stress The co..> | 2018-04-24 03:34 | 52K | |
| 8-High Stress The Cr..> | 2018-04-24 03:34 | 61K | |
| 8-High Stress My Lif..> | 2018-04-24 03:34 | 647K | |
| 8-High Stress Lower ..> | 2018-04-24 03:34 | 21K | |
| 7-Template Teen Butt..> | 2018-04-24 03:34 | 1.0M | |
| 7-Prayer & Body Chec..> | 2018-04-24 03:34 | 46K | |
| 7-High Anxiety The L..> | 2018-04-24 03:34 | 44K | |
| 7-High Anxiety The H..> | 2018-04-24 03:34 | 25K | |
| 7-High Anxiety Incre..> | 2018-04-24 03:34 | 90K | |
| 7-HighAnxiety-Contro..> | 2018-06-25 21:31 | 99K | |
| 6.docx | 2018-04-24 03:34 | 97K | |
| 6-Template Countermo..> | 2018-04-24 03:34 | 1.0M | |
| 6-Nurturance The Hug..> | 2018-04-24 03:34 | 45K | |
| 6-Nurturance The Hug..> | 2018-04-24 03:34 | 45K | |
| 6-Nurturance The Hug..> | 2018-04-24 03:34 | 45K | |
| 6-Nurturance Random ..> | 2018-04-24 03:34 | 52K | |
| 6-Nurturance Random...> | 2018-04-24 03:34 | 52K | |
| 6-Nurturance PTR.docx | 2018-04-24 03:34 | 21K | |
| 6-Nurturance Home mo..> | 2018-04-24 03:34 | 99K | |
| 6-Nurturance Helping..> | 2018-04-24 03:34 | 39K | |
| 6-Nurturance Cups an..> | 2018-04-24 03:34 | 37K | |
| 6-Nurturance Cups.docx | 2018-04-24 03:34 | 37K | |
| 6-Nurturance 30 day...> | 2018-04-24 03:34 | 98K | |
| 5_text.jpg | 2018-04-24 03:34 | 5.2K | |
| 5_text-old.jpg | 2018-04-24 03:34 | 4.9K | |
| 5 Big Rocks.docx | 2018-04-24 03:34 | 226K | |
| 5.jpg | 2018-04-24 03:34 | 9.5K | |
| 5-Template Countermo..> | 2018-04-24 03:34 | 192K | |
| 5-Lost Daughter.docx | 2018-04-24 03:34 | 24K | |
| 5-Forgiveness The Hu..> | 2018-04-24 03:34 | 58K | |
| 5-Forgiveness The Ho..> | 2018-04-24 03:34 | 34K | |
| 5-Forgiveness The Em..> | 2018-04-24 03:34 | 64K | |
| 5-Forgiveness The Ap..> | 2018-04-24 03:34 | 147K | |
| 5-Forgiveness Memory..> | 2018-04-24 03:34 | 41K | |
| 5-Forgiveness Memory..> | 2018-04-24 03:34 | 41K | |
| 5-Forgiveness Healin..> | 2018-04-24 03:34 | 144K | |
| 5-Forgiveness Family..> | 2018-04-24 03:34 | 62K | |
| 5-Forgiveness Antwon..> | 2018-04-24 03:34 | 41K | |
| 5-Day Trainer Traini..> | 2018-04-24 03:34 | 541K | |
| 5-Day Trainer Traini..> | 2018-04-24 03:34 | 99K | |
| 5-Day Trainer Traini..> | 2018-04-24 03:34 | 495K | |
| 5-Day Trainer Traini..> | 2018-04-24 03:34 | 95K | |
| 5-Balance Reclaiming..> | 2018-04-24 03:34 | 134K | |
| 5-Balance Our Family..> | 2018-04-24 03:34 | 34K | |
| 5-Balance My Balance..> | 2018-04-24 03:34 | 162K | |
| 4_text.jpg | 2018-04-24 03:34 | 12K | |
| 4.jpg | 2018-04-24 03:34 | 27K | |
| 4-Physical or Mental..> | 2018-04-24 03:34 | 44K | |
| 4-Physical or Mental..> | 2018-04-24 03:34 | 41K | |
| 4-Physical or Mental..> | 2018-04-24 03:34 | 62K | |
| 4-Physical or Mental..> | 2018-04-24 03:34 | 48K | |
| 4-Lack of Connection..> | 2018-04-24 03:34 | 47K | |
| 4-Lack of Connection..> | 2018-04-24 03:34 | 25K | |
| 4-Lack of Connection..> | 2018-04-24 03:34 | 84K | |
| 4-Contract Template.ppt | 2018-04-24 03:34 | 1.6M | |
| 4-Brain or Mental Im..> | 2018-04-24 03:34 | 31K | |
| 4-Brain or Mental Im..> | 2018-04-24 03:34 | 202K | |
| 4-Brain or Mental Im..> | 2018-04-24 03:34 | 86K | |
| 3_text.jpg | 2018-04-24 03:34 | 8.2K | |
| 3StepSupervisorInter..> | 2018-04-24 03:34 | 44K | |
| 3.jpg | 2018-04-24 03:34 | 11K | |
| 3-old.jpg | 2018-04-24 03:34 | 14K | |
| 3-Template Feedback ..> | 2018-04-24 03:34 | 1.0M | |
| 3-Forgiveness The Em..> | 2018-04-24 03:34 | 62K | |
| 3-Forgiveness Memory..> | 2018-04-24 03:34 | 41K | |
| 3-Forgiveness Healin..> | 2018-04-24 03:34 | 144K | |
| 3-Forgiveness Daily ..> | 2018-04-24 03:34 | 64K | |
| 3-Forgiveness Antwon..> | 2018-04-24 03:34 | 41K | |
| 3-Family Secrets The..> | 2018-04-24 03:34 | 158K | |
| 3-Family Secrets The..> | 2018-04-24 03:34 | 52K | |
| 3- Family Secrets Or..> | 2018-04-24 03:34 | 23K | |
| 3-Family Secrets Fro..> | 2018-04-24 03:34 | 37K | |
| 3-Family Secrets Dif..> | 2018-04-24 03:34 | 33K | |
| 3-Chemical Imbalance..> | 2018-04-24 03:34 | 57K | |
| 3-Chemical Imbalance..> | 2018-04-24 03:34 | 78K | |
| 3-Chemical Imbalance..> | 2018-04-24 03:34 | 65K | |
| 2 sisters chore cont..> | 2021-03-02 18:45 | 43K | |
| 2_text.jpg | 2018-04-24 03:34 | 17K | |
| 2_store.jpg | 2018-04-24 03:34 | 1.9K | |
| 2_sample.jpg | 2018-04-24 03:34 | 3.7K | |
| 2_register.jpg | 2018-04-24 03:34 | 2.7K | |
| 2_old.jpg | 2018-04-24 03:34 | 26K | |
| 2_help.jpg | 2018-04-24 03:34 | 2.2K | |
| 2_find.jpg | 2018-04-24 03:34 | 1.3K | |
| 2_discuss.jpg | 2018-04-24 03:34 | 2.4K | |
| 2_calender.jpg | 2018-04-24 03:34 | 1.6K | |
| 2_ask.jpg | 2018-04-24 03:34 | 1.9K | |
| 2.jpg | 2018-04-24 03:34 | 27K | |
| 2-day Co-Facilitator..> | 2018-04-24 03:34 | 549K | |
| 2-day Co-Facilitator..> | 2018-04-24 03:34 | 69K | |
| 2-Template Seed-Tree..> | 2018-04-24 03:34 | 2.2M | |
| 2-Normality and Acco..> | 2018-04-24 03:34 | 49K | |
| 2-Normality and Acco..> | 2018-04-24 03:34 | 37K | |
| 2-Normality and Acco..> | 2018-04-24 03:34 | 47K | |
| 2-Normality and Acco..> | 2018-04-24 03:34 | 22K | |
| 2-Normality and Acco..> | 2018-04-24 03:34 | 34K | |
| 2-Attachment Wild At..> | 2018-04-24 03:34 | 21K | |
| 2-Attachment The Fre..> | 2018-04-24 03:34 | 168K | |
| 2-Attachment Restori..> | 2018-04-24 03:34 | 42K | |
| 2-Attachment Random ..> | 2018-04-24 03:34 | 49K | |
| 2-Attachment Increas..> | 2018-04-24 03:34 | 158K | |
| 2-Attachment Fosteri..> | 2018-04-24 03:34 | 45K | |
| 2-Attachment Acts of..> | 2018-04-24 03:34 | 71K | |
| 2-Abandonment The Fr..> | 2018-04-24 03:34 | 168K | |
| 2-Abandonment Streng..> | 2018-04-24 03:34 | 42K | |
| 2-Abandonment Increa..> | 2018-04-24 03:34 | 29K | |
| 2-Abandonment Helpin..> | 2018-04-24 03:34 | 44K | |
| 2-Abandonment Foster..> | 2018-04-24 03:34 | 45K | |
| 1_text.jpg | 2018-04-24 03:34 | 6.3K | |
| 1_text-old.jpg | 2018-04-24 03:34 | 18K | |
| 1_setup_workshop.gif | 2018-04-24 03:34 | 966 | |
| 1.pptx | 2018-04-24 03:34 | 1.5M | |
| 1.jpg | 2018-04-24 03:34 | 11K | |
| 1-Two Track Hybrid S..> | 2018-04-24 03:34 | 23K | |
| 1-Two Track Hybrid N..> | 2018-04-24 03:34 | 23K | |
| 1-Two Track Hybrid L..> | 2018-04-24 03:34 | 23K | |
| 1-Two Track Hybrid H..> | 2018-04-24 03:34 | 23K | |
| 1-Template Stress Ch..> | 2018-04-24 03:34 | 215K | |
| 1-Memories for Dad.docx | 2018-04-24 03:34 | 22K | |
| 1-Memorial for Dad.docx | 2018-04-24 03:34 | 21K | |
| 1-Maslow's Safety&Se..> | 2018-04-24 03:34 | 42K | |
| 1-Maslow's Physiolog..> | 2018-04-24 03:34 | 33K | |
| 1-Maslow's Esteem Ne..> | 2018-04-24 03:34 | 64K | |
| 1-Grief & Loss Scrap..> | 2018-04-24 03:34 | 22K | |
| 1-Grief & Loss Runni..> | 2018-04-24 03:34 | 24K | |
| 1-Grief & Loss Openi..> | 2018-04-24 03:34 | 49K | |
| 1-Grief & Loss Heali..> | 2018-04-24 03:34 | 29K | |
| 1-Grief & Loss Creat..> | 2018-04-24 03:34 | 78K | |
| 1-Grief & Loss Build..> | 2018-04-24 03:34 | 21K | |
| 1-Grief & Loss Ballo..> | 2018-04-24 03:34 | 27K | |
| 1-Drawn out Medical ..> | 2018-04-24 03:34 | 62K | |
| 1-Drawn out Medical ..> | 2018-04-24 03:34 | 46K | |
| 1-Drawn out Medical ..> | 2018-04-24 03:34 | 202K | |
| 08-09PLLSummaryNotes..> | 2018-04-24 03:34 | 123K | |
| 08-09CARReportChart.pdf | 2018-04-24 03:34 | 158K | |
| 07-09CARReport.pdf | 2018-04-24 03:34 | 135K | |
| 07-08PLLSummaryNotes..> | 2018-04-24 03:34 | 82K | |
| 07-08CARReportChart.pdf | 2018-04-24 03:34 | 116K | |